C17H14FN3O3S — CID 7631083
(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 7631083) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7631083 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CCc1nn2c(=O)cc(COC(=O)/C=C/c3ccc(F)cc3)nc2s1 |
| InChI | InChI=1S/C17H14FN3O3S/c1-2-14-20-21-15(22)9-13(19-17(21)25-14)10-24-16(23)8-5-11-3-6-12(18)7-4-11/h3-9H,2,10H2,1H3/b8-5+ |
| InChIKey | PQMHUAWCVAVJAC-VMPITWQZSA-N |
| XLogP | 2.61 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|