C21H17N3O3S2 — CID 46626463
(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 46626463) has the molecular formula C21H17N3O3S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46626463 |
| Molecular Formula | C21H17N3O3S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | CCc1nn2c(=O)cc(COC(=O)/C=C/c3ccc(-c4ccccc4)s3)nc2s1 |
| InChI | InChI=1S/C21H17N3O3S2/c1-2-18-23-24-19(25)12-15(22-21(24)29-18)13-27-20(26)11-9-16-8-10-17(28-16)14-6-4-3-5-7-14/h3-12H,2,13H2,1H3/b11-9+ |
| InChIKey | HDTFKTCIUINVET-PKNBQFBNSA-N |
| XLogP | 4.20 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|