C22H17N3O2S — CID 27924813
(4-aminoquinazolin-2-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 27924813) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 27924813 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | Nc1nc(COC(=O)/C=C/c2ccc(-c3ccccc3)s2)nc2ccccc12 |
| InChI | InChI=1S/C22H17N3O2S/c23-22-17-8-4-5-9-18(17)24-20(25-22)14-27-21(26)13-11-16-10-12-19(28-16)15-6-2-1-3-7-15/h1-13H,14H2,(H2,23,24,25)/b13-11+ |
| InChIKey | ZZTUISFDLXDWBU-ACCUITESSA-N |
| XLogP | 4.70 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|