C19H15N3O4 — CID 23860977
2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedinitrile (PubChem CID 23860977) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 23860977 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedinitrile |
| SMILES | CCOc1cc(C=C(C#N)C#N)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N3O4/c1-2-25-19-10-15(9-16(11-20)12-21)5-8-18(19)26-13-14-3-6-17(7-4-14)22(23)24/h3-10H,2,13H2,1H3 |
| InChIKey | NQPQVJSUFRVDCK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 109.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|