C19H18N2O4 — CID 966542
(E)-3-(3,4-diethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 966542) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 966542 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(/C=C(/C#N)c2ccc([N+](=O)[O-])cc2)cc1OCC |
| InChI | InChI=1S/C19H18N2O4/c1-3-24-18-10-5-14(12-19(18)25-4-2)11-16(13-20)15-6-8-17(9-7-15)21(22)23/h5-12H,3-4H2,1-2H3/b16-11- |
| InChIKey | QOVPYAMOYXPHCH-WJDWOHSUSA-N |
| XLogP | 4.46 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|