C22H23NO6 — CID 22681793
2-cyano-3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 22681793) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22681793 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CCOc1ccccc1OCCOc1ccc(C=C(C#N)C(=O)O)cc1OCC |
| InChI | InChI=1S/C22H23NO6/c1-3-26-18-7-5-6-8-19(18)28-11-12-29-20-10-9-16(14-21(20)27-4-2)13-17(15-23)22(24)25/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,24,25) |
| InChIKey | APRUUBOXEOBFFW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|