C42H56N2O6 — CID 139830877
2-[[4-[10-[4-(2-cyano-4,4-dimethyl-3-oxopent-1-enyl)-2-ethoxyphenoxy]decoxy]-3-ethoxyphenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 139830877) has the molecular formula C42H56N2O6 and a molecular weight of 684.92 g/mol. Its IUPAC name is 2-[[4-[10-[4-(2-cyano-4,4-dimethyl-3-oxopent-1-enyl)-2-ethoxyphenoxy]decoxy]-3-ethoxyphenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-[[4-[10-[4-(2-cyano-4,4-dimethyl-3-oxopent-1-enyl)-2-ethoxyphenoxy]decoxy]-3-ethoxyphenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 139830877 |
| Molecular Formula | C42H56N2O6 |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.41 |
| IUPAC Name | 2-[[4-[10-[4-(2-cyano-4,4-dimethyl-3-oxopent-1-enyl)-2-ethoxyphenoxy]decoxy]-3-ethoxyphenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CCOc1cc(C=C(C#N)C(=O)C(C)(C)C)ccc1OCCCCCCCCCCOc1ccc(C=C(C#N)C(=O)C(C)(C)C)cc1OCC |
| InChI | InChI=1S/C42H56N2O6/c1-9-47-37-27-31(25-33(29-43)39(45)41(3,4)5)19-21-35(37)49-23-17-15-13-11-12-14-16-18-24-50-36-22-20-32(28-38(36)48-10-2)26-34(30-44)40(46)42(6,7)8/h19-22,25-28H,9-18,23-24H2,1-8H3 |
| InChIKey | XKAPPDHYPAFPGI-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|