C32H51NO4 — CID 170874357
ethyl (E)-2-cyano-3-(3,4-didecoxyphenyl)prop-2-enoate (PubChem CID 170874357) has the molecular formula C32H51NO4 and a molecular weight of 513.76 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(3,4-didecoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(3,4-didecoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 170874357 |
| Molecular Formula | C32H51NO4 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | ethyl (E)-2-cyano-3-(3,4-didecoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCCCOc1ccc(/C=C(\C#N)C(=O)OCC)cc1OCCCCCCCCCC |
| InChI | InChI=1S/C32H51NO4/c1-4-7-9-11-13-15-17-19-23-36-30-22-21-28(25-29(27-33)32(34)35-6-3)26-31(30)37-24-20-18-16-14-12-10-8-5-2/h21-22,25-26H,4-20,23-24H2,1-3H3/b29-25+ |
| InChIKey | HTLGHBLGUOKONO-XLVZBRSZSA-N |
| XLogP | 9.20 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|