C20H26N2O5 — CID 6532371
ethyl (E)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate (PubChem CID 6532371) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6532371 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OCCN2CCOCC2)c(OCC)c1 |
| InChI | InChI=1S/C20H26N2O5/c1-3-25-19-14-16(13-17(15-21)20(23)26-4-2)5-6-18(19)27-12-9-22-7-10-24-11-8-22/h5-6,13-14H,3-4,7-12H2,1-2H3/b17-13+ |
| InChIKey | MQKUBDYJVZCFBT-GHRIWEEISA-N |
| XLogP | 2.27 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|