C18H21N3O5 — CID 7276228
(Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide (PubChem CID 7276228) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7276228 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(N)=O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H21N3O5/c1-2-25-16-10-13(9-14(11-19)18(20)23)3-4-15(16)26-12-17(22)21-5-7-24-8-6-21/h3-4,9-10H,2,5-8,12H2,1H3,(H2,20,23)/b14-9- |
| InChIKey | WQMDNZKBWCGQRY-ZROIWOOFSA-N |
| XLogP | 0.72 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|