C16H20N2O6 — CID 954014
2-[2-ethoxy-4-[(E)-2-nitroethenyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 954014) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-2-nitroethenyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-ethoxy-4-[(E)-2-nitroethenyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 954014 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-2-nitroethenyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CCOc1cc(/C=C/[N+](=O)[O-])ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H20N2O6/c1-2-23-15-11-13(5-6-18(20)21)3-4-14(15)24-12-16(19)17-7-9-22-10-8-17/h3-6,11H,2,7-10,12H2,1H3/b6-5+ |
| InChIKey | LTTFPUGEFQUOCA-AATRIKPKSA-N |
| XLogP | 1.57 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|