C24H24ClN3O5 — CID 126025111
(Z)-N-(4-chlorophenyl)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide (PubChem CID 126025111) has the molecular formula C24H24ClN3O5 and a molecular weight of 469.93 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126025111 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H24ClN3O5/c1-2-32-22-14-17(3-8-21(22)33-16-23(29)28-9-11-31-12-10-28)13-18(15-26)24(30)27-20-6-4-19(25)5-7-20/h3-8,13-14H,2,9-12,16H2,1H3,(H,27,30)/b18-13- |
| InChIKey | XDHNZWGCUMFXLV-AQTBWJFISA-N |
| XLogP | 3.52 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|