C20H16ClN2O5- — CID 2213184
2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate (PubChem CID 2213184) has the molecular formula C20H16ClN2O5- and a molecular weight of 399.81 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 2213184 |
| Molecular Formula | C20H16ClN2O5- |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccc(Cl)cc2)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C20H17ClN2O5/c1-2-27-18-10-13(3-8-17(18)28-12-19(24)25)9-14(11-22)20(26)23-16-6-4-15(21)5-7-16/h3-10H,2,12H2,1H3,(H,23,26)(H,24,25)/p-1/b14-9+ |
| InChIKey | RWMYFVBJZHDOGN-NTEUORMPSA-M |
| XLogP | 2.41 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|