C21H28N2O5 — CID 23007446
propan-2-yl (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate (PubChem CID 23007446) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is propan-2-yl (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 23007446 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | propan-2-yl (Z)-2-cyano-3-[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)OC(C)C)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C21H28N2O5/c1-4-26-20-14-17(13-18(15-22)21(24)28-16(2)3)5-6-19(20)27-12-9-23-7-10-25-11-8-23/h5-6,13-14,16H,4,7-12H2,1-3H3/b18-13- |
| InChIKey | IOJYTJMQJVHGID-AQTBWJFISA-N |
| XLogP | 2.65 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|