C18H17NO3 — CID 51277764
(4-cyano-2-methoxyphenyl) 3-(4-methylphenyl)propanoate (PubChem CID 51277764) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 3-(4-methylphenyl)propanoate.
| Compound Name | (4-cyano-2-methoxyphenyl) 3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 51277764 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 3-(4-methylphenyl)propanoate |
| SMILES | COc1cc(C#N)ccc1OC(=O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-13-3-5-14(6-4-13)8-10-18(20)22-16-9-7-15(12-19)11-17(16)21-2/h3-7,9,11H,8,10H2,1-2H3 |
| InChIKey | XOAGMQZBINYCOY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|