C19H22O3 — CID 176892680
(4-ethyl-2-methoxyphenyl) 3-(4-methylphenyl)propanoate (PubChem CID 176892680) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (4-ethyl-2-methoxyphenyl) 3-(4-methylphenyl)propanoate.
| Compound Name | (4-ethyl-2-methoxyphenyl) 3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 176892680 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (4-ethyl-2-methoxyphenyl) 3-(4-methylphenyl)propanoate |
| SMILES | CCc1ccc(OC(=O)CCc2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H22O3/c1-4-15-9-11-17(18(13-15)21-3)22-19(20)12-10-16-7-5-14(2)6-8-16/h5-9,11,13H,4,10,12H2,1-3H3 |
| InChIKey | YLZZUZXOTUPLCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|