C19H14N2O3S — CID 27674976
(4-cyano-2-methoxyphenyl) 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 27674976) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | (4-cyano-2-methoxyphenyl) 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 27674976 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1cc(C#N)ccc1OC(=O)c1csc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C19H14N2O3S/c1-12-3-6-14(7-4-12)18-21-15(11-25-18)19(22)24-16-8-5-13(10-20)9-17(16)23-2/h3-9,11H,1-2H3 |
| InChIKey | JWXODSPRSWHHLU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|