About (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate
(4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 36766660) has the molecular formula C16H10N2O4S
and a molecular weight of 326.33 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 36766660 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1cc(C#N)ccc1OC(=O)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C16H10N2O4S/c1-20-14-7-10(8-17)4-5-12(14)22-16(19)11-9-23-15(18-11)13-3-2-6-21-13/h2-7,9H,1H3 |
| InChIKey | WBFXFNNHORTTMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate (CID 36766660) is (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate is COc1cc(C#N)ccc1OC(=O)c1csc(-c2ccco2)n1.
What is the InChIKey of (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is WBFXFNNHORTTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4S/c1-20-14-7-10(8-17)4-5-12(14)22-16(19)11-9-23-15(18-11)13-3-2-6-21-13/h2-7,9H,1H3.
What are the key properties of (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
(4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 326.33 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 36766660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).