C16H10N2O4S — CID 36766660
(4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 36766660) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 36766660 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1cc(C#N)ccc1OC(=O)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C16H10N2O4S/c1-20-14-7-10(8-17)4-5-12(14)22-16(19)11-9-23-15(18-11)13-3-2-6-21-13/h2-7,9H,1H3 |
| InChIKey | WBFXFNNHORTTMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|