C17H10N2O2S — CID 78905650
4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]benzonitrile (PubChem CID 78905650) has the molecular formula C17H10N2O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]benzonitrile.
| Compound Name | 4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]benzonitrile |
|---|---|
| PubChem CID | 78905650 |
| Molecular Formula | C17H10N2O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-[3-[2-(furan-2-yl)-1,3-thiazol-4-yl]prop-2-enoyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)C=Cc2csc(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C17H10N2O2S/c18-10-12-3-5-13(6-4-12)15(20)8-7-14-11-22-17(19-14)16-2-1-9-21-16/h1-9,11H |
| InChIKey | SPEUIAARWQOCJN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|