C16H10INOS2 — CID 60583193
(E)-1-(4-iodophenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 60583193) has the molecular formula C16H10INOS2 and a molecular weight of 423.30 g/mol. Its IUPAC name is (E)-1-(4-iodophenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-iodophenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60583193 |
| Molecular Formula | C16H10INOS2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.92 |
| IUPAC Name | (E)-1-(4-iodophenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1csc(-c2ccsc2)n1)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H10INOS2/c17-13-3-1-11(2-4-13)15(19)6-5-14-10-21-16(18-14)12-7-8-20-9-12/h1-10H/b6-5+ |
| InChIKey | PZHPDGACILYYLN-AATRIKPKSA-N |
| XLogP | 5.37 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|