C19H12ClNO3S — CID 8858555
(E)-1-(1,3-benzodioxol-5-yl)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]prop-2-en-1-one (PubChem CID 8858555) has the molecular formula C19H12ClNO3S and a molecular weight of 369.83 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8858555 |
| Molecular Formula | C19H12ClNO3S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1csc(-c2ccc(Cl)cc2)n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H12ClNO3S/c20-14-4-1-12(2-5-14)19-21-15(10-25-19)6-7-16(22)13-3-8-17-18(9-13)24-11-23-17/h1-10H,11H2/b7-6+ |
| InChIKey | ZBYGMEMEPZIXFE-VOTSOKGWSA-N |
| XLogP | 5.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|