C14H11NO3S — CID 75364917
(E)-1-(1,3-benzodioxol-5-yl)-3-(4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one (PubChem CID 75364917) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-(4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75364917 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one |
| SMILES | Cc1ncsc1/C=C/C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H11NO3S/c1-9-14(19-7-15-9)5-3-11(16)10-2-4-12-13(6-10)18-8-17-12/h2-7H,8H2,1H3/b5-3+ |
| InChIKey | OMFPCLRLGKQYFJ-HWKANZROSA-N |
| XLogP | 3.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|