C14H8Br2O3S — CID 19568997
(E)-1-(1,3-benzodioxol-5-yl)-3-(4,5-dibromothiophen-2-yl)prop-2-en-1-one (PubChem CID 19568997) has the molecular formula C14H8Br2O3S and a molecular weight of 416.09 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-(4,5-dibromothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(4,5-dibromothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19568997 |
| Molecular Formula | C14H8Br2O3S |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 413.86 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(4,5-dibromothiophen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)c(Br)s1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H8Br2O3S/c15-10-6-9(20-14(10)16)2-3-11(17)8-1-4-12-13(5-8)19-7-18-12/h1-6H,7H2/b3-2+ |
| InChIKey | HGUHLVMIMFYXPR-NSCUHMNNSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|