C17H11BrF2O4 — CID 7947683
(E)-1-(1,3-benzodioxol-5-yl)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 7947683) has the molecular formula C17H11BrF2O4 and a molecular weight of 397.17 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 7947683 |
| Molecular Formula | C17H11BrF2O4 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)ccc1OC(F)F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11BrF2O4/c18-12-3-6-14(24-17(19)20)11(7-12)1-4-13(21)10-2-5-15-16(8-10)23-9-22-15/h1-8,17H,9H2/b4-1+ |
| InChIKey | USJMMHZXQRUTBA-DAFODLJHSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|