C20H20O5 — CID 4822629
1-(1,3-benzodioxol-5-yl)-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-en-1-one (PubChem CID 4822629) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4822629 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(C=CC(=O)c2ccc3c(c2)OCO3)c1OC(C)C |
| InChI | InChI=1S/C20H20O5/c1-13(2)25-20-14(5-4-6-18(20)22-3)7-9-16(21)15-8-10-17-19(11-15)24-12-23-17/h4-11,13H,12H2,1-3H3 |
| InChIKey | CLJYGNBKTQGDTK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|