C16H14Br2OS — CID 19557336
(E)-3-(4,5-dibromothiophen-2-yl)-1-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 19557336) has the molecular formula C16H14Br2OS and a molecular weight of 414.16 g/mol. Its IUPAC name is (E)-3-(4,5-dibromothiophen-2-yl)-1-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4,5-dibromothiophen-2-yl)-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19557336 |
| Molecular Formula | C16H14Br2OS |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | (E)-3-(4,5-dibromothiophen-2-yl)-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | CC(C)c1ccc(C(=O)/C=C/c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C16H14Br2OS/c1-10(2)11-3-5-12(6-4-11)15(19)8-7-13-9-14(17)16(18)20-13/h3-10H,1-2H3/b8-7+ |
| InChIKey | LAZMRLIBTFDUQZ-BQYQJAHWSA-N |
| XLogP | 6.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|