C14H10Br2OS — CID 19571019
(E)-3-(4,5-dibromothiophen-2-yl)-1-(3-methylphenyl)prop-2-en-1-one (PubChem CID 19571019) has the molecular formula C14H10Br2OS and a molecular weight of 386.11 g/mol. Its IUPAC name is (E)-3-(4,5-dibromothiophen-2-yl)-1-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4,5-dibromothiophen-2-yl)-1-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19571019 |
| Molecular Formula | C14H10Br2OS |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | (E)-3-(4,5-dibromothiophen-2-yl)-1-(3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(C(=O)/C=C/c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C14H10Br2OS/c1-9-3-2-4-10(7-9)13(17)6-5-11-8-12(15)14(16)18-11/h2-8H,1H3/b6-5+ |
| InChIKey | CWERWTXYKQFFAO-AATRIKPKSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|