C15H17NO3 — CID 122378248
(E)-1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylprop-2-en-1-one (PubChem CID 122378248) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 122378248 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/N1CCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H17NO3/c17-13(6-9-16-7-2-1-3-8-16)12-4-5-14-15(10-12)19-11-18-14/h4-6,9-10H,1-3,7-8,11H2/b9-6+ |
| InChIKey | QAOUGWQYENXEIU-RMKNXTFCSA-N |
| XLogP | 2.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|