C16H13NO4 — CID 5345379
(Z)-1-(1,3-benzodioxol-5-yl)-3-(2-hydroxyanilino)prop-2-en-1-one (PubChem CID 5345379) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is (Z)-1-(1,3-benzodioxol-5-yl)-3-(2-hydroxyanilino)prop-2-en-1-one.
| Compound Name | (Z)-1-(1,3-benzodioxol-5-yl)-3-(2-hydroxyanilino)prop-2-en-1-one |
|---|---|
| PubChem CID | 5345379 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (Z)-1-(1,3-benzodioxol-5-yl)-3-(2-hydroxyanilino)prop-2-en-1-one |
| SMILES | O=C(/C=C\Nc1ccccc1O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13NO4/c18-13(7-8-17-12-3-1-2-4-14(12)19)11-5-6-15-16(9-11)21-10-20-15/h1-9,17,19H,10H2/b8-7- |
| InChIKey | BYBORHQOABCBCJ-FPLPWBNLSA-N |
| XLogP | 2.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|