C17H15N3O5 — CID 5348394
(Z)-1-(1,3-benzodioxol-5-yl)-3-[2-(methylamino)-4-nitroanilino]prop-2-en-1-one (PubChem CID 5348394) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is (Z)-1-(1,3-benzodioxol-5-yl)-3-[2-(methylamino)-4-nitroanilino]prop-2-en-1-one.
| Compound Name | (Z)-1-(1,3-benzodioxol-5-yl)-3-[2-(methylamino)-4-nitroanilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 5348394 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (Z)-1-(1,3-benzodioxol-5-yl)-3-[2-(methylamino)-4-nitroanilino]prop-2-en-1-one |
| SMILES | CNc1cc([N+](=O)[O-])ccc1N/C=C\C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15N3O5/c1-18-14-9-12(20(22)23)3-4-13(14)19-7-6-15(21)11-2-5-16-17(8-11)25-10-24-16/h2-9,18-19H,10H2,1H3/b7-6- |
| InChIKey | AIUHEKMBOKJZTM-SREVYHEPSA-N |
| XLogP | 3.17 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|