C16H11Cl2NO3 — CID 882611
(E)-3-(1,3-benzodioxol-5-ylamino)-1-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 882611) has the molecular formula C16H11Cl2NO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-ylamino)-1-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-ylamino)-1-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 882611 |
| Molecular Formula | C16H11Cl2NO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-ylamino)-1-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/Nc1ccc2c(c1)OCO2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2NO3/c17-12-3-1-10(7-13(12)18)14(20)5-6-19-11-2-4-15-16(8-11)22-9-21-15/h1-8,19H,9H2/b6-5+ |
| InChIKey | UMSDKYCINBQVCK-AATRIKPKSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|