C23H19NO4 — CID 51045579
(E)-1-(1,3-benzodioxol-5-yl)-3-(4-phenylmethoxyanilino)prop-2-en-1-one (PubChem CID 51045579) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-(4-phenylmethoxyanilino)prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(4-phenylmethoxyanilino)prop-2-en-1-one |
|---|---|
| PubChem CID | 51045579 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(4-phenylmethoxyanilino)prop-2-en-1-one |
| SMILES | O=C(/C=C/Nc1ccc(OCc2ccccc2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19NO4/c25-21(18-6-11-22-23(14-18)28-16-27-22)12-13-24-19-7-9-20(10-8-19)26-15-17-4-2-1-3-5-17/h1-14,24H,15-16H2/b13-12+ |
| InChIKey | PZOHMXSDIDKBHC-OUKQBFOZSA-N |
| XLogP | 4.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|