C10H6ClNO2S — CID 116892273
2-(1,3-benzodioxol-5-yl)-4-chloro-1,3-thiazole (PubChem CID 116892273) has the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-chloro-1,3-thiazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-chloro-1,3-thiazole |
|---|---|
| PubChem CID | 116892273 |
| Molecular Formula | C10H6ClNO2S |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-chloro-1,3-thiazole |
| SMILES | Clc1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C10H6ClNO2S/c11-9-4-15-10(12-9)6-1-2-7-8(3-6)14-5-13-7/h1-4H,5H2 |
| InChIKey | YDPMBXPSVONNFU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |