C11H9NO3S — CID 116891760
2-(1,3-benzodioxol-5-yl)-4-methoxy-1,3-thiazole (PubChem CID 116891760) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-methoxy-1,3-thiazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-methoxy-1,3-thiazole |
|---|---|
| PubChem CID | 116891760 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-methoxy-1,3-thiazole |
| SMILES | COc1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C11H9NO3S/c1-13-10-5-16-11(12-10)7-2-3-8-9(4-7)15-6-14-8/h2-5H,6H2,1H3 |
| InChIKey | GRGPINLGOJFMLI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |