C16H11NO3S — CID 28942294
3-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenol (PubChem CID 28942294) has the molecular formula C16H11NO3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 28942294 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1cccc(-c2nc(-c3ccc4c(c3)OCO4)cs2)c1 |
| InChI | InChI=1S/C16H11NO3S/c18-12-3-1-2-11(6-12)16-17-13(8-21-16)10-4-5-14-15(7-10)20-9-19-14/h1-8,18H,9H2 |
| InChIKey | CHWAPGDTWVELHG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |