C18H15NO2S — CID 9320259
4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-phenyl-1,3-thiazole (PubChem CID 9320259) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-phenyl-1,3-thiazole.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 9320259 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2nc(-c3ccc4c(c3)OCCCO4)cs2)cc1 |
| InChI | InChI=1S/C18H15NO2S/c1-2-5-13(6-3-1)18-19-15(12-22-18)14-7-8-16-17(11-14)21-10-4-9-20-16/h1-3,5-8,11-12H,4,9-10H2 |
| InChIKey | RXQXYJXKVGFXKI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |