C17H13NO3S — CID 46943636
[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-phenylmethanol (PubChem CID 46943636) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-phenylmethanol.
| Compound Name | [4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 46943636 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C17H13NO3S/c19-16(11-4-2-1-3-5-11)17-18-13(9-22-17)12-6-7-14-15(8-12)21-10-20-14/h1-9,16,19H,10H2 |
| InChIKey | PPGTYYWQCHYYIT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |