C13H14N2O2S — CID 62651876
2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]propan-1-amine (PubChem CID 62651876) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]propan-1-amine.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 62651876 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]propan-1-amine |
| SMILES | CC(CN)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C13H14N2O2S/c1-8(5-14)13-15-10(6-18-13)9-2-3-11-12(4-9)17-7-16-11/h2-4,6,8H,5,7,14H2,1H3 |
| InChIKey | ZNKKVAGWRILWDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |