C13H12N2O2 — CID 83918221
[6-(1,3-benzodioxol-5-yl)-3-pyridinyl]methanamine (PubChem CID 83918221) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-yl)-3-pyridinyl]methanamine.
| Compound Name | [6-(1,3-benzodioxol-5-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 83918221 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | [6-(1,3-benzodioxol-5-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(-c2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C13H12N2O2/c14-6-9-1-3-11(15-7-9)10-2-4-12-13(5-10)17-8-16-12/h1-5,7H,6,8,14H2 |
| InChIKey | SVVICVMMVACFLF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |