C15H10FNOS — CID 28942301
3-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]phenol (PubChem CID 28942301) has the molecular formula C15H10FNOS and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 3-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 28942301 |
| Molecular Formula | C15H10FNOS |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1cccc(-c2nc(-c3ccccc3F)cs2)c1 |
| InChI | InChI=1S/C15H10FNOS/c16-13-7-2-1-6-12(13)14-9-19-15(17-14)10-4-3-5-11(18)8-10/h1-9,18H |
| InChIKey | DOAFKIGHNMYQOU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |