C15H11NO2S — CID 169215045
4-(4-phenyl-1,3-thiazol-2-yl)benzene-1,2-diol (PubChem CID 169215045) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(4-phenyl-1,3-thiazol-2-yl)benzene-1,2-diol.
| Compound Name | 4-(4-phenyl-1,3-thiazol-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 169215045 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-(4-phenyl-1,3-thiazol-2-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(-c2nc(-c3ccccc3)cs2)cc1O |
| InChI | InChI=1S/C15H11NO2S/c17-13-7-6-11(8-14(13)18)15-16-12(9-19-15)10-4-2-1-3-5-10/h1-9,17-18H |
| InChIKey | OQIOXGQUTGUZRI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|