C17H15NO2S — CID 1147052
2-(3,4-dimethoxyphenyl)-4-phenyl-1,3-thiazole (PubChem CID 1147052) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 1147052 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-phenyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)cs2)cc1OC |
| InChI | InChI=1S/C17H15NO2S/c1-19-15-9-8-13(10-16(15)20-2)17-18-14(11-21-17)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | GBRFZCYNYHEMAA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |