C17H18Cl2N2O3S — CID 18707378
2-amino-4-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol;dihydrochloride (PubChem CID 18707378) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 2-amino-4-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol;dihydrochloride.
| Compound Name | 2-amino-4-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 18707378 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-amino-4-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol;dihydrochloride |
| SMILES | COc1ccc(-c2nc(-c3ccc(O)c(N)c3)cs2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C17H16N2O3S.2ClH/c1-21-15-6-4-11(8-16(15)22-2)17-19-13(9-23-17)10-3-5-14(20)12(18)7-10;;/h3-9,20H,18H2,1-2H3;2*1H |
| InChIKey | XXMADUSUTSQLIR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|