C16H13NO3S — CID 170172156
4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol (PubChem CID 170172156) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol.
| Compound Name | 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 170172156 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol |
| SMILES | COc1ccc(-c2csc(-c3ccc(O)c(O)c3)n2)cc1 |
| InChI | InChI=1S/C16H13NO3S/c1-20-12-5-2-10(3-6-12)13-9-21-16(17-13)11-4-7-14(18)15(19)8-11/h2-9,18-19H,1H3 |
| InChIKey | WZFWEIUVNKDOJF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|