C17H13NO3S — CID 137047911
[4-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate (PubChem CID 137047911) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is [4-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate.
| Compound Name | [4-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 137047911 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [4-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2csc(-c3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C17H13NO3S/c1-11(19)21-15-8-4-12(5-9-15)16-10-22-17(18-16)13-2-6-14(20)7-3-13/h2-10,20H,1H3 |
| InChIKey | WNCIVEFYUWJONN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|