C24H23FN2O4S2 — CID 129193988
4-[2-[4-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]phenol (PubChem CID 129193988) has the molecular formula C24H23FN2O4S2 and a molecular weight of 486.59 g/mol. Its IUPAC name is 4-[2-[4-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-[4-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 129193988 |
| Molecular Formula | C24H23FN2O4S2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-[2-[4-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]phenol |
| SMILES | Oc1ccc(-c2csc(-c3nc(-c4ccc(OCCOCCOCCF)cc4)cs3)n2)cc1 |
| InChI | InChI=1S/C24H23FN2O4S2/c25-9-10-29-11-12-30-13-14-31-20-7-3-18(4-8-20)22-16-33-24(27-22)23-26-21(15-32-23)17-1-5-19(28)6-2-17/h1-8,15-16,28H,9-14H2 |
| InChIKey | ZZAFWMSMJAWMEL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|