C24H24N2OS2 — CID 20944735
2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-(4-methylphenyl)-1,3-thiazole (PubChem CID 20944735) has the molecular formula C24H24N2OS2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 20944735 |
| Molecular Formula | C24H24N2OS2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-(4-methylphenyl)-1,3-thiazole |
| SMILES | CCCCOc1ccc(-c2csc(-c3nc(-c4ccc(C)cc4)c(C)s3)n2)cc1 |
| InChI | InChI=1S/C24H24N2OS2/c1-4-5-14-27-20-12-10-18(11-13-20)21-15-28-23(25-21)24-26-22(17(3)29-24)19-8-6-16(2)7-9-19/h6-13,15H,4-5,14H2,1-3H3 |
| InChIKey | HSWDEGARVAEMJH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|