C27H36N2OS — CID 21282291
N-butyl-N-[1-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine (PubChem CID 21282291) has the molecular formula C27H36N2OS and a molecular weight of 436.67 g/mol. Its IUPAC name is N-butyl-N-[1-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[1-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine |
|---|---|
| PubChem CID | 21282291 |
| Molecular Formula | C27H36N2OS |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-butyl-N-[1-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)C(CC)Oc1ccc(-c2csc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H36N2OS/c1-5-8-18-29(19-9-6-2)26(7-3)30-24-16-14-22(15-17-24)25-20-31-27(28-25)23-12-10-21(4)11-13-23/h10-17,20,26H,5-9,18-19H2,1-4H3 |
| InChIKey | USZYDJHBDYKKMQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|