C19H20N2OS — CID 82152285
5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-propoxyaniline (PubChem CID 82152285) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-propoxyaniline.
| Compound Name | 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-propoxyaniline |
|---|---|
| PubChem CID | 82152285 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-propoxyaniline |
| SMILES | CCCOc1ccc(-c2nc(-c3ccc(C)cc3)cs2)cc1N |
| InChI | InChI=1S/C19H20N2OS/c1-3-10-22-18-9-8-15(11-16(18)20)19-21-17(12-23-19)14-6-4-13(2)5-7-14/h4-9,11-12H,3,10,20H2,1-2H3 |
| InChIKey | ZBUSDYSRFRWUKB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|