C18H18N2O2S — CID 82152286
2-[2-amino-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenoxy]ethanol (PubChem CID 82152286) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[2-amino-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenoxy]ethanol.
| Compound Name | 2-[2-amino-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenoxy]ethanol |
|---|---|
| PubChem CID | 82152286 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[2-amino-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenoxy]ethanol |
| SMILES | Cc1ccc(-c2csc(-c3ccc(OCCO)c(N)c3)n2)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-12-2-4-13(5-3-12)16-11-23-18(20-16)14-6-7-17(15(19)10-14)22-9-8-21/h2-7,10-11,21H,8-9,19H2,1H3 |
| InChIKey | BEOJISLQFSGWKI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|